C10H17FN2O2 — CID 137358606
tert-butyl N-[(Z)-(2-fluorocyclopentylidene)amino]carbamate (PubChem CID 137358606) has the molecular formula C10H17FN2O2 and a molecular weight of 216.26 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(2-fluorocyclopentylidene)amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(2-fluorocyclopentylidene)amino]carbamate |
|---|---|
| PubChem CID | 137358606 |
| Molecular Formula | C10H17FN2O2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | tert-butyl N-[(Z)-(2-fluorocyclopentylidene)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C1/CCCC1F |
| InChI | InChI=1S/C10H17FN2O2/c1-10(2,3)15-9(14)13-12-8-6-4-5-7(8)11/h7H,4-6H2,1-3H3,(H,13,14)/b12-8- |
| InChIKey | ZBWQBLNVGDXGPY-WQLSENKSSA-N |
| XLogP | 2.39 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|