C22H23N3O5S — CID 137363967
(3S)-3-[[3-amino-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 137363967) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is (3S)-3-[[3-amino-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid.
| Compound Name | (3S)-3-[[3-amino-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 137363967 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (3S)-3-[[3-amino-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(C#Cc2cc(N)c(C(=O)N[C@H]3CCCN(C(=O)O)C3)s2)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-2-30-21(27)15-8-5-14(6-9-15)7-10-17-12-18(23)19(31-17)20(26)24-16-4-3-11-25(13-16)22(28)29/h5-6,8-9,12,16H,2-4,11,13,23H2,1H3,(H,24,26)(H,28,29)/t16-/m0/s1 |
| InChIKey | QBHHFKHPVOYOJA-INIZCTEOSA-N |
| XLogP | 2.78 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|