C23H24N4O6S — CID 137363994
3-[[3-(carbamoylamino)-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 137363994) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[[3-(carbamoylamino)-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[3-(carbamoylamino)-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 137363994 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[[3-(carbamoylamino)-5-[2-(4-ethoxycarbonylphenyl)ethynyl]thiophene-2-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(C#Cc2cc(NC(N)=O)c(C(=O)NC3CCCN(C(=O)O)C3)s2)cc1 |
| InChI | InChI=1S/C23H24N4O6S/c1-2-33-21(29)15-8-5-14(6-9-15)7-10-17-12-18(26-22(24)30)19(34-17)20(28)25-16-4-3-11-27(13-16)23(31)32/h5-6,8-9,12,16H,2-4,11,13H2,1H3,(H,25,28)(H,31,32)(H3,24,26,30) |
| InChIKey | JVINQLRDIBSMID-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|