About ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate
ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate (PubChem CID 95293945) has the molecular formula C17H24N2O3S
and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate |
| PubChem CID | 95293945 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CCCN(C(=O)[C@@H]2C[C@@H]2c2ccc(C)s2)C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-3-22-17(21)18-12-5-4-8-19(10-12)16(20)14-9-13(14)15-7-6-11(2)23-15/h6-7,12-14H,3-5,8-10H2,1-2H3,(H,18,21)/t12-,13+,14-/m1/s1 |
| InChIKey | WEJFECMZGLMGKN-HZSPNIEDSA-N |
| XLogP | 2.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate?
The IUPAC name of ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate (CID 95293945) is ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate.
What is the SMILES notation for ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate?
The canonical SMILES for ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate is CCOC(=O)N[C@@H]1CCCN(C(=O)[C@@H]2C[C@@H]2c2ccc(C)s2)C1.
What is the InChIKey of ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate?
The InChIKey is WEJFECMZGLMGKN-HZSPNIEDSA-N. The full InChI is InChI=1S/C17H24N2O3S/c1-3-22-17(21)18-12-5-4-8-19(10-12)16(20)14-9-13(14)15-7-6-11(2)23-15/h6-7,12-14H,3-5,8-10H2,1-2H3,(H,18,21)/t12-,13+,14-/m1/s1.
What are the key properties of ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate?
ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate has a molecular weight of 336.46 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3R)-1-[(1R,2S)-2-(5-methylthiophen-2-yl)cyclopropanecarbonyl]piperidin-3-yl]carbamate is sourced from PubChem (CID 95293945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).