C17H17N7O — CID 137367429
N-[[(2R,3S)-1-cyano-2-methylpyrrolidin-3-yl]methyl]-1-(3-cyanophenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 137367429) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[[(2R,3S)-1-cyano-2-methylpyrrolidin-3-yl]methyl]-1-(3-cyanophenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[[(2R,3S)-1-cyano-2-methylpyrrolidin-3-yl]methyl]-1-(3-cyanophenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 137367429 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[[(2R,3S)-1-cyano-2-methylpyrrolidin-3-yl]methyl]-1-(3-cyanophenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | C[C@@H]1[C@H](CNC(=O)c2ncn(-c3cccc(C#N)c3)n2)CCN1C#N |
| InChI | InChI=1S/C17H17N7O/c1-12-14(5-6-23(12)10-19)9-20-17(25)16-21-11-24(22-16)15-4-2-3-13(7-15)8-18/h2-4,7,11-12,14H,5-6,9H2,1H3,(H,20,25)/t12-,14+/m1/s1 |
| InChIKey | RRAYLIYQUZTBNG-OCCSQVGLSA-N |
| XLogP | 1.06 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|