C14H15N3O3 — CID 137368671
3-[(2-methyl-1-oxo-3H-isoindol-5-yl)amino]piperidine-2,6-dione (PubChem CID 137368671) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[(2-methyl-1-oxo-3H-isoindol-5-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(2-methyl-1-oxo-3H-isoindol-5-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 137368671 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-[(2-methyl-1-oxo-3H-isoindol-5-yl)amino]piperidine-2,6-dione |
| SMILES | CN1Cc2cc(NC3CCC(=O)NC3=O)ccc2C1=O |
| InChI | InChI=1S/C14H15N3O3/c1-17-7-8-6-9(2-3-10(8)14(17)20)15-11-4-5-12(18)16-13(11)19/h2-3,6,11,15H,4-5,7H2,1H3,(H,16,18,19) |
| InChIKey | CFJWRLYLBMQGBP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|