About azetidin-1-ylsulfonyl cyclohexanecarboxylate
azetidin-1-ylsulfonyl cyclohexanecarboxylate (PubChem CID 137371666) has the molecular formula C10H17NO4S
and a molecular weight of 247.32 g/mol. Its IUPAC name is azetidin-1-ylsulfonyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | azetidin-1-ylsulfonyl cyclohexanecarboxylate |
| PubChem CID | 137371666 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | azetidin-1-ylsulfonyl cyclohexanecarboxylate |
| SMILES | O=C(OS(=O)(=O)N1CCC1)C1CCCCC1 |
| InChI | InChI=1S/C10H17NO4S/c12-10(9-5-2-1-3-6-9)15-16(13,14)11-7-4-8-11/h9H,1-8H2 |
| InChIKey | CVJZPJDVNGWLDP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azetidin-1-ylsulfonyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-ylsulfonyl cyclohexanecarboxylate?
The IUPAC name of azetidin-1-ylsulfonyl cyclohexanecarboxylate (CID 137371666) is azetidin-1-ylsulfonyl cyclohexanecarboxylate.
What is the SMILES notation for azetidin-1-ylsulfonyl cyclohexanecarboxylate?
The canonical SMILES for azetidin-1-ylsulfonyl cyclohexanecarboxylate is O=C(OS(=O)(=O)N1CCC1)C1CCCCC1.
What is the InChIKey of azetidin-1-ylsulfonyl cyclohexanecarboxylate?
The InChIKey is CVJZPJDVNGWLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4S/c12-10(9-5-2-1-3-6-9)15-16(13,14)11-7-4-8-11/h9H,1-8H2.
What are the key properties of azetidin-1-ylsulfonyl cyclohexanecarboxylate?
azetidin-1-ylsulfonyl cyclohexanecarboxylate has a molecular weight of 247.32 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-ylsulfonyl cyclohexanecarboxylate is sourced from PubChem (CID 137371666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).