C15H17BrN2O2 — CID 137374093
ethyl 1-amino-6-bromo-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate (PubChem CID 137374093) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is ethyl 1-amino-6-bromo-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate.
| Compound Name | ethyl 1-amino-6-bromo-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 137374093 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | ethyl 1-amino-6-bromo-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)C1Cc2c([nH]c3ccc(Br)cc23)C(N)C1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-2-20-15(19)8-5-11-10-7-9(16)3-4-13(10)18-14(11)12(17)6-8/h3-4,7-8,12,18H,2,5-6,17H2,1H3 |
| InChIKey | BOANRFMWVQYWNJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|