C15H20N2O — CID 67638542
8-amino-6-propyl-6,7,8,9-tetrahydro-5H-carbazol-3-ol (PubChem CID 67638542) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 8-amino-6-propyl-6,7,8,9-tetrahydro-5H-carbazol-3-ol.
| Compound Name | 8-amino-6-propyl-6,7,8,9-tetrahydro-5H-carbazol-3-ol |
|---|---|
| PubChem CID | 67638542 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 8-amino-6-propyl-6,7,8,9-tetrahydro-5H-carbazol-3-ol |
| SMILES | CCCC1Cc2c([nH]c3ccc(O)cc23)C(N)C1 |
| InChI | InChI=1S/C15H20N2O/c1-2-3-9-6-12-11-8-10(18)4-5-14(11)17-15(12)13(16)7-9/h4-5,8-9,13,17-18H,2-3,6-7,16H2,1H3 |
| InChIKey | IOMLYBTVIULTOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|