C21H22N4O3 — CID 67626637
[8-amino-6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(4-nitrophenyl)methanone (PubChem CID 67626637) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is [8-amino-6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(4-nitrophenyl)methanone.
| Compound Name | [8-amino-6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 67626637 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [8-amino-6-(ethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(4-nitrophenyl)methanone |
| SMILES | CCNC1Cc2c([nH]c3ccc(C(=O)c4ccc([N+](=O)[O-])cc4)cc23)C(N)C1 |
| InChI | InChI=1S/C21H22N4O3/c1-2-23-14-10-17-16-9-13(5-8-19(16)24-20(17)18(22)11-14)21(26)12-3-6-15(7-4-12)25(27)28/h3-9,14,18,23-24H,2,10-11,22H2,1H3 |
| InChIKey | LBQBVBCNFMCXJK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|