C10H11Cl2NO3 — CID 137375869
[(1S,2S)-1-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl] carbamate (PubChem CID 137375869) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is [(1S,2S)-1-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl] carbamate.
| Compound Name | [(1S,2S)-1-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl] carbamate |
|---|---|
| PubChem CID | 137375869 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | [(1S,2S)-1-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl] carbamate |
| SMILES | C[C@H](OC(N)=O)[C@@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c1-5(16-10(13)15)9(14)6-2-3-7(11)8(12)4-6/h2-5,9,14H,1H3,(H2,13,15)/t5-,9+/m0/s1 |
| InChIKey | HRXOMKQMMYKYGR-SSDLBLMSSA-N |
| XLogP | 2.51 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |