About [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate
[(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate (PubChem CID 94821905) has the molecular formula C15H12Cl2N2O3
and a molecular weight of 339.18 g/mol. Its IUPAC name is [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate |
| PubChem CID | 94821905 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc(C(N)=O)cn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c1-8(9-2-4-11(16)12(17)6-9)22-15(21)13-5-3-10(7-19-13)14(18)20/h2-8H,1H3,(H2,18,20)/t8-/m0/s1 |
| InChIKey | TZLNQFKDXOULOV-QMMMGPOBSA-N |
| XLogP | 3.41 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate?
The IUPAC name of [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate (CID 94821905) is [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate.
What is the SMILES notation for [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate?
The canonical SMILES for [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate is C[C@H](OC(=O)c1ccc(C(N)=O)cn1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate?
The InChIKey is TZLNQFKDXOULOV-QMMMGPOBSA-N. The full InChI is InChI=1S/C15H12Cl2N2O3/c1-8(9-2-4-11(16)12(17)6-9)22-15(21)13-5-3-10(7-19-13)14(18)20/h2-8H,1H3,(H2,18,20)/t8-/m0/s1.
What are the key properties of [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate?
[(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate has a molecular weight of 339.18 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(3,4-dichlorophenyl)ethyl] 5-carbamoylpyridine-2-carboxylate is sourced from PubChem (CID 94821905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).