C15H12Cl2N2O3 — CID 51102555
1-(3,4-dichlorophenyl)ethyl 5-carbamoylpyridine-2-carboxylate (PubChem CID 51102555) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)ethyl 5-carbamoylpyridine-2-carboxylate.
| Compound Name | 1-(3,4-dichlorophenyl)ethyl 5-carbamoylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 51102555 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)ethyl 5-carbamoylpyridine-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(C(N)=O)cn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c1-8(9-2-4-11(16)12(17)6-9)22-15(21)13-5-3-10(7-19-13)14(18)20/h2-8H,1H3,(H2,18,20) |
| InChIKey | TZLNQFKDXOULOV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |