About bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate
bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate (PubChem CID 14210543) has the molecular formula C19H25NO8
and a molecular weight of 395.41 g/mol. Its IUPAC name is bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate.
Molecular Properties
| Compound Name | bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate |
| PubChem CID | 14210543 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate |
| SMILES | CC(C)OC(=O)C(C)OC(=O)c1ccc(C(=O)OC(C)C(=O)OC(C)C)nc1 |
| InChI | InChI=1S/C19H25NO8/c1-10(2)25-16(21)12(5)27-18(23)14-7-8-15(20-9-14)19(24)28-13(6)17(22)26-11(3)4/h7-13H,1-6H3 |
| InChIKey | LSSOUTVOEQSZQE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate?
The IUPAC name of bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate (CID 14210543) is bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate.
What is the SMILES notation for bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate?
The canonical SMILES for bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate is CC(C)OC(=O)C(C)OC(=O)c1ccc(C(=O)OC(C)C(=O)OC(C)C)nc1.
What is the InChIKey of bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate?
The InChIKey is LSSOUTVOEQSZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO8/c1-10(2)25-16(21)12(5)27-18(23)14-7-8-15(20-9-14)19(24)28-13(6)17(22)26-11(3)4/h7-13H,1-6H3.
What are the key properties of bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate?
bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate has a molecular weight of 395.41 g/mol, XLogP of 2.08, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate is sourced from PubChem (CID 14210543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).