C19H25NO8 — CID 14210543
bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate (PubChem CID 14210543) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate.
| Compound Name | bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 14210543 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | bis(1-oxo-1-propan-2-yloxypropan-2-yl) pyridine-2,5-dicarboxylate |
| SMILES | CC(C)OC(=O)C(C)OC(=O)c1ccc(C(=O)OC(C)C(=O)OC(C)C)nc1 |
| InChI | InChI=1S/C19H25NO8/c1-10(2)25-16(21)12(5)27-18(23)14-7-8-15(20-9-14)19(24)28-13(6)17(22)26-11(3)4/h7-13H,1-6H3 |
| InChIKey | LSSOUTVOEQSZQE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|