C14H18N2O4 — CID 158862567
ethyl 5-[(3-methyl-2-oxobutyl)carbamoyl]pyridine-2-carboxylate (PubChem CID 158862567) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 5-[(3-methyl-2-oxobutyl)carbamoyl]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[(3-methyl-2-oxobutyl)carbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 158862567 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl 5-[(3-methyl-2-oxobutyl)carbamoyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)NCC(=O)C(C)C)cn1 |
| InChI | InChI=1S/C14H18N2O4/c1-4-20-14(19)11-6-5-10(7-15-11)13(18)16-8-12(17)9(2)3/h5-7,9H,4,8H2,1-3H3,(H,16,18) |
| InChIKey | WGWRDZQWRWADDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |