C17H17FN2O5S — CID 19928247
ethyl 5-[2-(4-fluorophenyl)ethylsulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928247) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 5-[2-(4-fluorophenyl)ethylsulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[2-(4-fluorophenyl)ethylsulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928247 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | ethyl 5-[2-(4-fluorophenyl)ethylsulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)NS(=O)(=O)CCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C17H17FN2O5S/c1-2-25-17(22)15-8-5-13(11-19-15)16(21)20-26(23,24)10-9-12-3-6-14(18)7-4-12/h3-8,11H,2,9-10H2,1H3,(H,20,21) |
| InChIKey | NTYGJFXKWDXOKI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |