C19H22N2O5S — CID 19928468
ethyl 5-(4-phenylbutylsulfonylcarbamoyl)pyridine-2-carboxylate (PubChem CID 19928468) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 5-(4-phenylbutylsulfonylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | ethyl 5-(4-phenylbutylsulfonylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928468 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 5-(4-phenylbutylsulfonylcarbamoyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)NS(=O)(=O)CCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C19H22N2O5S/c1-2-26-19(23)17-12-11-16(14-20-17)18(22)21-27(24,25)13-7-6-10-15-8-4-3-5-9-15/h3-5,8-9,11-12,14H,2,6-7,10,13H2,1H3,(H,21,22) |
| InChIKey | KCQOIACNVXDFIY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|