C16H16N2O6S — CID 19928091
methyl 5-(2-phenoxyethylsulfonylcarbamoyl)pyridine-2-carboxylate (PubChem CID 19928091) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 5-(2-phenoxyethylsulfonylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(2-phenoxyethylsulfonylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928091 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | methyl 5-(2-phenoxyethylsulfonylcarbamoyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NS(=O)(=O)CCOc2ccccc2)cn1 |
| InChI | InChI=1S/C16H16N2O6S/c1-23-16(20)14-8-7-12(11-17-14)15(19)18-25(21,22)10-9-24-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,18,19) |
| InChIKey | JVAKGJCSLCEOIW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |