C18H19FN2O6S — CID 139669290
5-(butylsulfonylcarbamoyl)-3-[(4-fluorophenyl)methoxy]pyridine-2-carboxylic acid (PubChem CID 139669290) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is 5-(butylsulfonylcarbamoyl)-3-[(4-fluorophenyl)methoxy]pyridine-2-carboxylic acid.
| Compound Name | 5-(butylsulfonylcarbamoyl)-3-[(4-fluorophenyl)methoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 139669290 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 5-(butylsulfonylcarbamoyl)-3-[(4-fluorophenyl)methoxy]pyridine-2-carboxylic acid |
| SMILES | CCCCS(=O)(=O)NC(=O)c1cnc(C(=O)O)c(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FN2O6S/c1-2-3-8-28(25,26)21-17(22)13-9-15(16(18(23)24)20-10-13)27-11-12-4-6-14(19)7-5-12/h4-7,9-10H,2-3,8,11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | JWMKJGYLVWCRGL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |