C29H34FNO5 — CID 67715978
3-[(4-fluorophenyl)methoxy]-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonyl)pyridine-2-carboxylic acid (PubChem CID 67715978) has the molecular formula C29H34FNO5 and a molecular weight of 495.59 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonyl)pyridine-2-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)methoxy]-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67715978 |
| Molecular Formula | C29H34FNO5 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonyl)pyridine-2-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)c1cnc(C(=O)O)c(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H34FNO5/c1-20(2)7-5-8-21(3)9-6-10-22(4)15-16-35-29(34)24-17-26(27(28(32)33)31-18-24)36-19-23-11-13-25(30)14-12-23/h7,9,11-15,17-18H,5-6,8,10,16,19H2,1-4H3,(H,32,33) |
| InChIKey | BDXNRPRFVBZGQR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|