C17H14F3NO5 — CID 22923812
5-ethoxycarbonyl-3-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-2-carboxylic acid (PubChem CID 22923812) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is 5-ethoxycarbonyl-3-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-2-carboxylic acid.
| Compound Name | 5-ethoxycarbonyl-3-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22923812 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-ethoxycarbonyl-3-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-2-carboxylic acid |
| SMILES | CCOC(=O)c1cnc(C(=O)O)c(OCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H14F3NO5/c1-2-25-16(24)11-7-13(14(15(22)23)21-8-11)26-9-10-3-5-12(6-4-10)17(18,19)20/h3-8H,2,9H2,1H3,(H,22,23) |
| InChIKey | PXCZOWLSFJZSMG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |