C22H35N3O7S — CID 54557989
ethyl 2-[[5-(decylsulfonylcarbamoyl)-3-methoxypyridine-2-carbonyl]amino]acetate (PubChem CID 54557989) has the molecular formula C22H35N3O7S and a molecular weight of 485.60 g/mol. Its IUPAC name is ethyl 2-[[5-(decylsulfonylcarbamoyl)-3-methoxypyridine-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[5-(decylsulfonylcarbamoyl)-3-methoxypyridine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 54557989 |
| Molecular Formula | C22H35N3O7S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | ethyl 2-[[5-(decylsulfonylcarbamoyl)-3-methoxypyridine-2-carbonyl]amino]acetate |
| SMILES | CCCCCCCCCCS(=O)(=O)NC(=O)c1cnc(C(=O)NCC(=O)OCC)c(OC)c1 |
| InChI | InChI=1S/C22H35N3O7S/c1-4-6-7-8-9-10-11-12-13-33(29,30)25-21(27)17-14-18(31-3)20(23-15-17)22(28)24-16-19(26)32-5-2/h14-15H,4-13,16H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | ZONAROIAVQGQOB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|