C25H41N3O7 — CID 67697944
octyl 2-[[5-(3-butoxypropylcarbamoyl)-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate (PubChem CID 67697944) has the molecular formula C25H41N3O7 and a molecular weight of 495.62 g/mol. Its IUPAC name is octyl 2-[[5-(3-butoxypropylcarbamoyl)-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate.
| Compound Name | octyl 2-[[5-(3-butoxypropylcarbamoyl)-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 67697944 |
| Molecular Formula | C25H41N3O7 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | octyl 2-[[5-(3-butoxypropylcarbamoyl)-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate |
| SMILES | CCCCCCCCOC(=O)CNC(=O)Oc1ncc(C(=O)NCCCOCCCC)cc1OC |
| InChI | InChI=1S/C25H41N3O7/c1-4-6-8-9-10-11-16-34-22(29)19-28-25(31)35-24-21(32-3)17-20(18-27-24)23(30)26-13-12-15-33-14-7-5-2/h17-18H,4-16,19H2,1-3H3,(H,26,30)(H,28,31) |
| InChIKey | KZQKEGWKOFVIIT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|