C22H27N3O7 — CID 22363167
ethyl 2-[[5-[(4-butoxyphenyl)carbamoyl]-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate (PubChem CID 22363167) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is ethyl 2-[[5-[(4-butoxyphenyl)carbamoyl]-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate.
| Compound Name | ethyl 2-[[5-[(4-butoxyphenyl)carbamoyl]-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 22363167 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | ethyl 2-[[5-[(4-butoxyphenyl)carbamoyl]-3-methoxy-2-pyridinyl]oxycarbonylamino]acetate |
| SMILES | CCCCOc1ccc(NC(=O)c2cnc(OC(=O)NCC(=O)OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H27N3O7/c1-4-6-11-31-17-9-7-16(8-10-17)25-20(27)15-12-18(29-3)21(23-13-15)32-22(28)24-14-19(26)30-5-2/h7-10,12-13H,4-6,11,14H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | NRMCIHKMXIHOPJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|