C17H24N2O7 — CID 67697237
pentyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate (PubChem CID 67697237) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is pentyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate.
| Compound Name | pentyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 67697237 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | pentyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate |
| SMILES | CCCCCOC(=O)c1cnc(OC(=O)NCC(=O)OCC)c(OC)c1 |
| InChI | InChI=1S/C17H24N2O7/c1-4-6-7-8-25-16(21)12-9-13(23-3)15(18-10-12)26-17(22)19-11-14(20)24-5-2/h9-10H,4-8,11H2,1-3H3,(H,19,22) |
| InChIKey | JRBLVANVEBBNNQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|