C18H26N2O7 — CID 67698257
hexyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate (PubChem CID 67698257) has the molecular formula C18H26N2O7 and a molecular weight of 382.41 g/mol. Its IUPAC name is hexyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate.
| Compound Name | hexyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 67698257 |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | hexyl 6-[(2-ethoxy-2-oxoethyl)carbamoyloxy]-5-methoxypyridine-3-carboxylate |
| SMILES | CCCCCCOC(=O)c1cnc(OC(=O)NCC(=O)OCC)c(OC)c1 |
| InChI | InChI=1S/C18H26N2O7/c1-4-6-7-8-9-26-17(22)13-10-14(24-3)16(19-11-13)27-18(23)20-12-15(21)25-5-2/h10-11H,4-9,12H2,1-3H3,(H,20,23) |
| InChIKey | IXCPYIVSHOZBQH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|