C18H26N2O6 — CID 54026144
ethyl 6-[(2-butoxy-2-oxoethyl)carbamoyl]-5-propan-2-yloxypyridine-3-carboxylate (PubChem CID 54026144) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is ethyl 6-[(2-butoxy-2-oxoethyl)carbamoyl]-5-propan-2-yloxypyridine-3-carboxylate.
| Compound Name | ethyl 6-[(2-butoxy-2-oxoethyl)carbamoyl]-5-propan-2-yloxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 54026144 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl 6-[(2-butoxy-2-oxoethyl)carbamoyl]-5-propan-2-yloxypyridine-3-carboxylate |
| SMILES | CCCCOC(=O)CNC(=O)c1ncc(C(=O)OCC)cc1OC(C)C |
| InChI | InChI=1S/C18H26N2O6/c1-5-7-8-25-15(21)11-20-17(22)16-14(26-12(3)4)9-13(10-19-16)18(23)24-6-2/h9-10,12H,5-8,11H2,1-4H3,(H,20,22) |
| InChIKey | LCHRPIFWARCPGB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|