C37H40Cl2N6O3 — CID 137376363
4-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-2-carboxylic acid (PubChem CID 137376363) has the molecular formula C37H40Cl2N6O3 and a molecular weight of 687.67 g/mol. Its IUPAC name is 4-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 137376363 |
| Molecular Formula | C37H40Cl2N6O3 |
| Molecular Weight | 687.67 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 4-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(CCCCc2c(C(=O)N3CCN(c4ccnc(C(=O)O)c4)CC3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C37H40Cl2N6O3/c1-21-18-25(19-22(2)33(21)39)8-6-7-9-27-28-10-11-29(38)32(31-23(3)42-43(5)24(31)4)34(28)41-35(27)36(46)45-16-14-44(15-17-45)26-12-13-40-30(20-26)37(47)48/h10-13,18-20,41H,6-9,14-17H2,1-5H3,(H,47,48) |
| InChIKey | VYIHTKVBSZVALD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|