C7H14N2O2 — CID 137384260
ethoxy(1,4,5,6-tetrahydropyridazin-6-yl)methanol (PubChem CID 137384260) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is ethoxy(1,4,5,6-tetrahydropyridazin-6-yl)methanol.
| Compound Name | ethoxy(1,4,5,6-tetrahydropyridazin-6-yl)methanol |
|---|---|
| PubChem CID | 137384260 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | ethoxy(1,4,5,6-tetrahydropyridazin-6-yl)methanol |
| SMILES | CCOC(O)C1CCC=NN1 |
| InChI | InChI=1S/C7H14N2O2/c1-2-11-7(10)6-4-3-5-8-9-6/h5-7,9-10H,2-4H2,1H3 |
| InChIKey | HOGCTDKTRNPHLB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|