C12H18O4 — CID 134526927
(1R,4S)-3-[ethoxy(hydroxy)methyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 134526927) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1R,4S)-3-[ethoxy(hydroxy)methyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,4S)-3-[ethoxy(hydroxy)methyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 134526927 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1R,4S)-3-[ethoxy(hydroxy)methyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CCOC(O)C1C(C(=O)O)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C12H18O4/c1-2-16-12(15)10-8-5-3-7(4-6-8)9(10)11(13)14/h3,5,7-10,12,15H,2,4,6H2,1H3,(H,13,14)/t7-,8+,9?,10?,12?/m0/s1 |
| InChIKey | RWPAAMVHTJRMOJ-JPTHFSFUSA-N |
| XLogP | 1.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|