C16H24O6 — CID 23518098
3-[2,2-bis(hydroxymethyl)butoxycarbonyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 23518098) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[2,2-bis(hydroxymethyl)butoxycarbonyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | 3-[2,2-bis(hydroxymethyl)butoxycarbonyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 23518098 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[2,2-bis(hydroxymethyl)butoxycarbonyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CCC(CO)(CO)COC(=O)C1C2C=CC(CC2)C1C(=O)O |
| InChI | InChI=1S/C16H24O6/c1-2-16(7-17,8-18)9-22-15(21)13-11-5-3-10(4-6-11)12(13)14(19)20/h3,5,10-13,17-18H,2,4,6-9H2,1H3,(H,19,20) |
| InChIKey | MNFGDOPGAQOPFG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|