C10H11F2NO2 — CID 137389895
1-[3-(aminooxymethyl)phenyl]-1,1-difluoropropan-2-one (PubChem CID 137389895) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 1-[3-(aminooxymethyl)phenyl]-1,1-difluoropropan-2-one.
| Compound Name | 1-[3-(aminooxymethyl)phenyl]-1,1-difluoropropan-2-one |
|---|---|
| PubChem CID | 137389895 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1-[3-(aminooxymethyl)phenyl]-1,1-difluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)c1cccc(CON)c1 |
| InChI | InChI=1S/C10H11F2NO2/c1-7(14)10(11,12)9-4-2-3-8(5-9)6-15-13/h2-5H,6,13H2,1H3 |
| InChIKey | AIBHDAXGPLNBFQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|