C11H20O2S — CID 137390183
7-propan-2-yl-2λ6-thiaspiro[3.5]nonane 2,2-dioxide (PubChem CID 137390183) has the molecular formula C11H20O2S and a molecular weight of 216.35 g/mol. Its IUPAC name is 7-propan-2-yl-2λ6-thiaspiro[3.5]nonane 2,2-dioxide.
| Compound Name | 7-propan-2-yl-2λ6-thiaspiro[3.5]nonane 2,2-dioxide |
|---|---|
| PubChem CID | 137390183 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 7-propan-2-yl-2λ6-thiaspiro[3.5]nonane 2,2-dioxide |
| SMILES | CC(C)C1CCC2(CC1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C11H20O2S/c1-9(2)10-3-5-11(6-4-10)7-14(12,13)8-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | AQAZCYXBTCDTOC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |