C11H19NO2S — CID 165454557
N-cyclopropyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-amine (PubChem CID 165454557) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-cyclopropyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-amine.
| Compound Name | N-cyclopropyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-amine |
|---|---|
| PubChem CID | 165454557 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-cyclopropyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-amine |
| SMILES | O=S1(=O)CC2(CCC(NC3CC3)CC2)C1 |
| InChI | InChI=1S/C11H19NO2S/c13-15(14)7-11(8-15)5-3-10(4-6-11)12-9-1-2-9/h9-10,12H,1-8H2 |
| InChIKey | DIOBAKZEVSNUAM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |