C33H44N2S — CID 137390656
1-[[2,5-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]methyl]-3-[4-(2-ethylhexyl)phenyl]thiourea (PubChem CID 137390656) has the molecular formula C33H44N2S and a molecular weight of 500.80 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]methyl]-3-[4-(2-ethylhexyl)phenyl]thiourea.
| Compound Name | 1-[[2,5-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]methyl]-3-[4-(2-ethylhexyl)phenyl]thiourea |
|---|---|
| PubChem CID | 137390656 |
| Molecular Formula | C33H44N2S |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 1-[[2,5-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]methyl]-3-[4-(2-ethylhexyl)phenyl]thiourea |
| SMILES | CCCCC(CC)Cc1ccc(NC(=S)NCc2cc(C)c(-c3c(C)cc(C)cc3C)cc2C)cc1 |
| InChI | InChI=1S/C33H44N2S/c1-8-10-11-27(9-2)20-28-12-14-30(15-13-28)35-33(36)34-21-29-18-24(5)31(19-23(29)4)32-25(6)16-22(3)17-26(32)7/h12-19,27H,8-11,20-21H2,1-7H3,(H2,34,35,36) |
| InChIKey | STHQOAJDWFMMSO-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|