C16H11Cl2N3O2 — CID 137390981
8-(2,3-dichlorophenyl)-4-methoxycinnoline-3-carboxamide (PubChem CID 137390981) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)-4-methoxycinnoline-3-carboxamide.
| Compound Name | 8-(2,3-dichlorophenyl)-4-methoxycinnoline-3-carboxamide |
|---|---|
| PubChem CID | 137390981 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 8-(2,3-dichlorophenyl)-4-methoxycinnoline-3-carboxamide |
| SMILES | COc1c(C(N)=O)nnc2c(-c3cccc(Cl)c3Cl)cccc12 |
| InChI | InChI=1S/C16H11Cl2N3O2/c1-23-15-10-6-2-5-9(8-4-3-7-11(17)12(8)18)13(10)20-21-14(15)16(19)22/h2-7H,1H3,(H2,19,22) |
| InChIKey | GSTQBOGRNODVAO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |