C23H23Cl2N5O — CID 137396582
(2,4-dichlorophenyl)-[4,10,12-trimethyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 137396582) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[4,10,12-trimethyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | (2,4-dichlorophenyl)-[4,10,12-trimethyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 137396582 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (2,4-dichlorophenyl)-[4,10,12-trimethyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ccn[nH]2)c2c(n1)C1C(C)CC(C)C(C2)N1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N5O/c1-11-8-12(2)22-21-16(20(27-13(3)28-21)18-6-7-26-29-18)10-19(11)30(22)23(31)15-5-4-14(24)9-17(15)25/h4-7,9,11-12,19,22H,8,10H2,1-3H3,(H,26,29) |
| InChIKey | VJMJNNFMGCPFMK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |