C21H18Cl2FN5O — CID 118950257
(2,3-dichloro-4-fluorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 118950257) has the molecular formula C21H18Cl2FN5O and a molecular weight of 446.31 g/mol. Its IUPAC name is (2,3-dichloro-4-fluorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | (2,3-dichloro-4-fluorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 118950257 |
| Molecular Formula | C21H18Cl2FN5O |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | (2,3-dichloro-4-fluorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ccn[nH]2)c2c(n1)[C@H]1CCC[C@@H](C2)N1C(=O)c1ccc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C21H18Cl2FN5O/c1-10-26-19(15-7-8-25-28-15)13-9-11-3-2-4-16(20(13)27-10)29(11)21(30)12-5-6-14(24)18(23)17(12)22/h5-8,11,16H,2-4,9H2,1H3,(H,25,28)/t11-,16+/m0/s1 |
| InChIKey | WLQFZRKYTQBQKR-MEDUHNTESA-N |
| XLogP | 4.91 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|