C24H22F3N5O — CID 118949212
[(1R,9S)-4-methyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone (PubChem CID 118949212) has the molecular formula C24H22F3N5O and a molecular weight of 453.47 g/mol. Its IUPAC name is [(1R,9S)-4-methyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(1R,9S)-4-methyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 118949212 |
| Molecular Formula | C24H22F3N5O |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(1R,9S)-4-methyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1nc(-c2cnccn2)c2c(n1)[C@H]1CCC[C@@H](C2)N1C(=O)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C24H22F3N5O/c1-13-16(6-4-7-18(13)24(25,26)27)23(33)32-15-5-3-8-20(32)22-17(11-15)21(30-14(2)31-22)19-12-28-9-10-29-19/h4,6-7,9-10,12,15,20H,3,5,8,11H2,1-2H3/t15-,20+/m0/s1 |
| InChIKey | XWNYDEYWWOUJID-MGPUTAFESA-N |
| XLogP | 4.86 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |