C22H19F4N5O — CID 134426900
[5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone (PubChem CID 134426900) has the molecular formula C22H19F4N5O and a molecular weight of 445.42 g/mol. Its IUPAC name is [5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 134426900 |
| Molecular Formula | C22H19F4N5O |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(C(=O)N2C3CCCC2c2nnc(-c4ccc(F)cn4)n2C3)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H19F4N5O/c1-12-15(5-3-6-16(12)22(24,25)26)21(32)31-14-4-2-7-18(31)20-29-28-19(30(20)11-14)17-9-8-13(23)10-27-17/h3,5-6,8-10,14,18H,2,4,7,11H2,1H3 |
| InChIKey | QGZOAYBMDUQFOM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |