C20H17F2N5O2 — CID 90442656
(2-fluoro-3-methylphenyl)-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90442656) has the molecular formula C20H17F2N5O2 and a molecular weight of 397.39 g/mol. Its IUPAC name is (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90442656 |
| Molecular Formula | C20H17F2N5O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2[C@H]3COC[C@@H]2c2nnc(-c4ccc(F)cn4)n2C3)c1F |
| InChI | InChI=1S/C20H17F2N5O2/c1-11-3-2-4-14(17(11)22)20(28)27-13-8-26-18(15-6-5-12(21)7-23-15)24-25-19(26)16(27)10-29-9-13/h2-7,13,16H,8-10H2,1H3/t13-,16-/m1/s1 |
| InChIKey | LBSCWVARQVOSEF-CZUORRHYSA-N |
| XLogP | 2.52 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |