C20H17Cl2N5O3 — CID 90413887
(2,3-dichlorophenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90413887) has the molecular formula C20H17Cl2N5O3 and a molecular weight of 446.29 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90413887 |
| Molecular Formula | C20H17Cl2N5O3 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (2,3-dichlorophenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | COc1ccnc(-c2nnc3n2C[C@@H]2COC[C@H]3N2C(=O)c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N5O3/c1-29-12-5-6-23-15(7-12)18-24-25-19-16-10-30-9-11(8-26(18)19)27(16)20(28)13-3-2-4-14(21)17(13)22/h2-7,11,16H,8-10H2,1H3/t11-,16-/m1/s1 |
| InChIKey | NIVHRJSEEQQPNI-BDJLRTHQSA-N |
| XLogP | 3.25 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |