C17H13Cl2FN6O2 — CID 123294746
(2,3-dichloro-4-fluorophenyl)-[5-(1H-pyrazol-5-yl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 123294746) has the molecular formula C17H13Cl2FN6O2 and a molecular weight of 423.24 g/mol. Its IUPAC name is (2,3-dichloro-4-fluorophenyl)-[5-(1H-pyrazol-5-yl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2,3-dichloro-4-fluorophenyl)-[5-(1H-pyrazol-5-yl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 123294746 |
| Molecular Formula | C17H13Cl2FN6O2 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (2,3-dichloro-4-fluorophenyl)-[5-(1H-pyrazol-5-yl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1Cl)N1C2COCC1c1nnc(-c3ccn[nH]3)n1C2 |
| InChI | InChI=1S/C17H13Cl2FN6O2/c18-13-9(1-2-10(20)14(13)19)17(27)26-8-5-25-15(11-3-4-21-22-11)23-24-16(25)12(26)7-28-6-8/h1-4,8,12H,5-7H2,(H,21,22) |
| InChIKey | XXGQEAIVGMLVPD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|