C20H14F5N5O2 — CID 90414021
[(1S,8R)-5-(4-fluorophenyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanone (PubChem CID 90414021) has the molecular formula C20H14F5N5O2 and a molecular weight of 451.36 g/mol. Its IUPAC name is [(1S,8R)-5-(4-fluorophenyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanone.
| Compound Name | [(1S,8R)-5-(4-fluorophenyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 90414021 |
| Molecular Formula | C20H14F5N5O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | [(1S,8R)-5-(4-fluorophenyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methanone |
| SMILES | O=C(c1ccnc(C(F)(F)F)c1F)N1[C@H]2COC[C@@H]1c1nnc(-c3ccc(F)cc3)n1C2 |
| InChI | InChI=1S/C20H14F5N5O2/c21-11-3-1-10(2-4-11)17-27-28-18-14-9-32-8-12(7-29(17)18)30(14)19(31)13-5-6-26-16(15(13)22)20(23,24)25/h1-6,12,14H,7-9H2/t12-,14-/m1/s1 |
| InChIKey | YAKPALCTCBQGFA-TZMCWYRMSA-N |
| XLogP | 3.23 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |