C21H20FN5O3 — CID 90442659
(2-fluoro-3-methylphenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90442659) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90442659 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (2-fluoro-3-methylphenyl)-[(1S,8R)-5-(4-methoxy-2-pyridinyl)-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | COc1ccnc(-c2nnc3n2C[C@@H]2COC[C@H]3N2C(=O)c2cccc(C)c2F)c1 |
| InChI | InChI=1S/C21H20FN5O3/c1-12-4-3-5-15(18(12)22)21(28)27-13-9-26-19(16-8-14(29-2)6-7-23-16)24-25-20(26)17(27)11-30-10-13/h3-8,13,17H,9-11H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | PZECYIUEGKXKMT-CXAGYDPISA-N |
| XLogP | 2.39 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |