C20H14Cl2F3N5O3 — CID 123152764
(2,3-dichlorophenyl)-[5-[4-(trifluoromethoxy)-2-pyridinyl]-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 123152764) has the molecular formula C20H14Cl2F3N5O3 and a molecular weight of 500.26 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[5-[4-(trifluoromethoxy)-2-pyridinyl]-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[5-[4-(trifluoromethoxy)-2-pyridinyl]-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 123152764 |
| Molecular Formula | C20H14Cl2F3N5O3 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | (2,3-dichlorophenyl)-[5-[4-(trifluoromethoxy)-2-pyridinyl]-10-oxa-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1C2COCC1c1nnc(-c3cc(OC(F)(F)F)ccn3)n1C2 |
| InChI | InChI=1S/C20H14Cl2F3N5O3/c21-13-3-1-2-12(16(13)22)19(31)30-10-7-29-17(27-28-18(29)15(30)9-32-8-10)14-6-11(4-5-26-14)33-20(23,24)25/h1-6,10,15H,7-9H2 |
| InChIKey | ICIYAWIYLICQHR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |