C20H14ClF4N5O — CID 87056407
[2-chloro-4-fluoro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyridin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone (PubChem CID 87056407) has the molecular formula C20H14ClF4N5O and a molecular weight of 451.81 g/mol. Its IUPAC name is [2-chloro-4-fluoro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyridin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone.
| Compound Name | [2-chloro-4-fluoro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyridin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
|---|---|
| PubChem CID | 87056407 |
| Molecular Formula | C20H14ClF4N5O |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [2-chloro-4-fluoro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyridin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
| SMILES | O=C(c1ccc(F)c(C(F)(F)F)c1Cl)N1[C@@H]2CC[C@@H]1c1nnc(-c3ccccn3)n1C2 |
| InChI | InChI=1S/C20H14ClF4N5O/c21-16-11(5-6-12(22)15(16)20(23,24)25)19(31)30-10-4-7-14(30)18-28-27-17(29(18)9-10)13-3-1-2-8-26-13/h1-3,5-6,8,10,14H,4,7,9H2/t10-,14-/m1/s1 |
| InChIKey | XOBAFBCJBBPMMO-QMTHXVAHSA-N |
| XLogP | 4.51 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |