C18H13ClF3N5OS — CID 90414826
[2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone (PubChem CID 90414826) has the molecular formula C18H13ClF3N5OS and a molecular weight of 439.85 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
|---|---|
| PubChem CID | 90414826 |
| Molecular Formula | C18H13ClF3N5OS |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(1,3-thiazol-4-yl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1Cl)N1[C@H]2CC[C@@H]1c1nnc(-c3cscn3)n1C2 |
| InChI | InChI=1S/C18H13ClF3N5OS/c19-14-10(2-1-3-11(14)18(20,21)22)17(28)27-9-4-5-13(27)16-25-24-15(26(16)6-9)12-7-29-8-23-12/h1-3,7-9,13H,4-6H2/t9-,13+/m0/s1 |
| InChIKey | MUGFFAOGIBZAEJ-TVQRCGJNSA-N |
| XLogP | 4.43 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |