C21H19Cl2N5O — CID 118949375
(2,3-dichlorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 118949375) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 118949375 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2,3-dichlorophenyl)-[(1R,9S)-4-methyl-6-(1H-pyrazol-5-yl)-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ccn[nH]2)c2c(n1)[C@H]1CCC[C@@H](C2)N1C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H19Cl2N5O/c1-11-25-19(16-8-9-24-27-16)14-10-12-4-2-7-17(20(14)26-11)28(12)21(29)13-5-3-6-15(22)18(13)23/h3,5-6,8-9,12,17H,2,4,7,10H2,1H3,(H,24,27)/t12-,17+/m0/s1 |
| InChIKey | HYBKURCESSHZEZ-YVEFUNNKSA-N |
| XLogP | 4.77 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |