C23H25Cl2N5O — CID 147334466
[(1R,9S,12R)-6-[C-(2-aminoethenyl)-N-methylcarbonimidoyl]-4,12-dimethyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-(2,3-dichlorophenyl)methanone (PubChem CID 147334466) has the molecular formula C23H25Cl2N5O and a molecular weight of 458.39 g/mol. Its IUPAC name is [(1R,9S,12R)-6-[C-(2-aminoethenyl)-N-methylcarbonimidoyl]-4,12-dimethyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-(2,3-dichlorophenyl)methanone.
| Compound Name | [(1R,9S,12R)-6-[C-(2-aminoethenyl)-N-methylcarbonimidoyl]-4,12-dimethyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 147334466 |
| Molecular Formula | C23H25Cl2N5O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [(1R,9S,12R)-6-[C-(2-aminoethenyl)-N-methylcarbonimidoyl]-4,12-dimethyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-(2,3-dichlorophenyl)methanone |
| SMILES | C/N=C(\C=CN)c1nc(C)nc2c1C[C@@H]1CC[C@@H](C)[C@H]2N1C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H25Cl2N5O/c1-12-7-8-14-11-16-20(18(27-3)9-10-26)28-13(2)29-21(16)22(12)30(14)23(31)15-5-4-6-17(24)19(15)25/h4-6,9-10,12,14,22H,7-8,11,26H2,1-3H3/b10-9?,27-18+/t12-,14+,22-/m1/s1 |
| InChIKey | KQNQTKYASCKDOA-PPLJYGCSSA-N |
| XLogP | 4.52 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|